(2,3,4,5,6-pentafluorophenyl) prop-2-enoate
Catalog No: FT-0715546
CAS No: 71195-85-2
- Chemical Name: (2,3,4,5,6-pentafluorophenyl) prop-2-enoate
- Molecular Formula: C9H3F5O2
- Molecular Weight: 238.11
- InChI Key: RFOWDPMCXHVGET-UHFFFAOYSA-N
- InChI: InChI=1S/C9H3F5O2/c1-2-3(15)16-9-7(13)5(11)4(10)6(12)8(9)14/h2H,1H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 71195-85-2 |
|---|---|
| MF: | C9H3F5O2 |
| Density: | 1.49g/cm3 |
| Flash_Point: | 88.6ºC |
| Melting_Point: | N/A |
| Product_Name: | (2,3,4,5,6-pentafluorophenyl) prop-2-enoate |
| Symbol: | GHS07 |
| Bolling_Point: | 145-149ºC |
| FW: | 238.11100 |
| Density: | 1.49g/cm3 |
|---|---|
| MF: | C9H3F5O2 |
| LogP: | 2.47350 |
| Exact_Mass: | 238.00500 |
| Bolling_Point: | 145-149ºC |
| Flash_Point: | 88.6ºC |
| FW: | 238.11100 |
| Refractive_Index: | 1.437 |
| PSA: | 26.30000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | 26-36/37/39 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | 36/37/38 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)